C17H17N3OS — CID 4842959
5-methyl-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)phenol (PubChem CID 4842959) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 5-methyl-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)phenol.
| Compound Name | 5-methyl-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)phenol |
|---|---|
| PubChem CID | 4842959 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 5-methyl-2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)phenol |
| SMILES | Cc1ccc(Nc2ncnc3sc4c(c23)CCCC4)c(O)c1 |
| InChI | InChI=1S/C17H17N3OS/c1-10-6-7-12(13(21)8-10)20-16-15-11-4-2-3-5-14(11)22-17(15)19-9-18-16/h6-9,21H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | SEAFQIQNGDBAAF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|