C20H16BrN3OS — CID 21010275
2-[[5-(4-bromophenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]-5-methylphenol (PubChem CID 21010275) has the molecular formula C20H16BrN3OS and a molecular weight of 426.34 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]-5-methylphenol.
| Compound Name | 2-[[5-(4-bromophenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]-5-methylphenol |
|---|---|
| PubChem CID | 21010275 |
| Molecular Formula | C20H16BrN3OS |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2-[[5-(4-bromophenyl)-6-methylthieno[2,3-d]pyrimidin-4-yl]amino]-5-methylphenol |
| SMILES | Cc1ccc(Nc2ncnc3sc(C)c(-c4ccc(Br)cc4)c23)c(O)c1 |
| InChI | InChI=1S/C20H16BrN3OS/c1-11-3-8-15(16(25)9-11)24-19-18-17(13-4-6-14(21)7-5-13)12(2)26-20(18)23-10-22-19/h3-10,25H,1-2H3,(H,22,23,24) |
| InChIKey | NDWUIUIKPSPDIA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|