C22H22N4S — CID 21012140
4-N,4-N-dimethyl-1-N-[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine (PubChem CID 21012140) has the molecular formula C22H22N4S and a molecular weight of 374.51 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 21012140 |
| Molecular Formula | C22H22N4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-[6-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine |
| SMILES | Cc1ccc(-c2c(C)sc3ncnc(Nc4ccc(N(C)C)cc4)c23)cc1 |
| InChI | InChI=1S/C22H22N4S/c1-14-5-7-16(8-6-14)19-15(2)27-22-20(19)21(23-13-24-22)25-17-9-11-18(12-10-17)26(3)4/h5-13H,1-4H3,(H,23,24,25) |
| InChIKey | ZSIPGYWYPGTLSJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|