C25H27N5S — CID 21011969
6-methyl-5-(4-methylphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 21011969) has the molecular formula C25H27N5S and a molecular weight of 429.59 g/mol. Its IUPAC name is 6-methyl-5-(4-methylphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-methyl-5-(4-methylphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21011969 |
| Molecular Formula | C25H27N5S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 6-methyl-5-(4-methylphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-c2c(C)sc3ncnc(Nc4ccc(N5CCN(C)CC5)cc4)c23)cc1 |
| InChI | InChI=1S/C25H27N5S/c1-17-4-6-19(7-5-17)22-18(2)31-25-23(22)24(26-16-27-25)28-20-8-10-21(11-9-20)30-14-12-29(3)13-15-30/h4-11,16H,12-15H2,1-3H3,(H,26,27,28) |
| InChIKey | YROCDWDRGUQLAH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|