C25H26N4S — CID 21012118
5-(3,4-dimethylphenyl)-6-methyl-N-(4-pyrrolidin-1-ylphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 21012118) has the molecular formula C25H26N4S and a molecular weight of 414.58 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-6-methyl-N-(4-pyrrolidin-1-ylphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(3,4-dimethylphenyl)-6-methyl-N-(4-pyrrolidin-1-ylphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21012118 |
| Molecular Formula | C25H26N4S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-6-methyl-N-(4-pyrrolidin-1-ylphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-c2c(C)sc3ncnc(Nc4ccc(N5CCCC5)cc4)c23)cc1C |
| InChI | InChI=1S/C25H26N4S/c1-16-6-7-19(14-17(16)2)22-18(3)30-25-23(22)24(26-15-27-25)28-20-8-10-21(11-9-20)29-12-4-5-13-29/h6-11,14-15H,4-5,12-13H2,1-3H3,(H,26,27,28) |
| InChIKey | OQMQJXIUCCFUIK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|