C23H22FN5S — CID 21011948
5-(4-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 21011948) has the molecular formula C23H22FN5S and a molecular weight of 419.53 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21011948 |
| Molecular Formula | C23H22FN5S |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncnc4scc(-c5ccc(F)cc5)c34)cc2)CC1 |
| InChI | InChI=1S/C23H22FN5S/c1-28-10-12-29(13-11-28)19-8-6-18(7-9-19)27-22-21-20(14-30-23(21)26-15-25-22)16-2-4-17(24)5-3-16/h2-9,14-15H,10-13H2,1H3,(H,25,26,27) |
| InChIKey | HLZRSUQIGLYYAP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|