C18H13AsFN3O3S — CID 112501307
[4-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenyl]arsonic acid (PubChem CID 112501307) has the molecular formula C18H13AsFN3O3S and a molecular weight of 445.31 g/mol. Its IUPAC name is [4-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenyl]arsonic acid.
| Compound Name | [4-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenyl]arsonic acid |
|---|---|
| PubChem CID | 112501307 |
| Molecular Formula | C18H13AsFN3O3S |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | [4-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenyl]arsonic acid |
| SMILES | O=[As](O)(O)c1ccc(Nc2ncnc3scc(-c4ccc(F)cc4)c23)cc1 |
| InChI | InChI=1S/C18H13AsFN3O3S/c20-13-5-1-11(2-6-13)15-9-27-18-16(15)17(21-10-22-18)23-14-7-3-12(4-8-14)19(24,25)26/h1-10H,(H,21,22,23)(H2,24,25,26) |
| InChIKey | NQLXJMURGKPKMO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|