C18H14AsN3O3S — CID 112501316
[4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]arsonic acid (PubChem CID 112501316) has the molecular formula C18H14AsN3O3S and a molecular weight of 427.32 g/mol. Its IUPAC name is [4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]arsonic acid.
| Compound Name | [4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]arsonic acid |
|---|---|
| PubChem CID | 112501316 |
| Molecular Formula | C18H14AsN3O3S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | [4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]arsonic acid |
| SMILES | O=[As](O)(O)c1ccc(Nc2ncnc3scc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C18H14AsN3O3S/c23-19(24,25)13-6-8-14(9-7-13)22-17-16-15(12-4-2-1-3-5-12)10-26-18(16)21-11-20-17/h1-11H,(H,20,21,22)(H2,23,24,25) |
| InChIKey | BBOBBQLMDJXECV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|