C22H22ClN3OS — CID 44635936
N-(4-butoxyphenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine;hydrochloride (PubChem CID 44635936) has the molecular formula C22H22ClN3OS and a molecular weight of 411.96 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine;hydrochloride.
| Compound Name | N-(4-butoxyphenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 44635936 |
| Molecular Formula | C22H22ClN3OS |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-(4-butoxyphenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine;hydrochloride |
| SMILES | CCCCOc1ccc(Nc2ncnc3scc(-c4ccccc4)c23)cc1.Cl |
| InChI | InChI=1S/C22H21N3OS.ClH/c1-2-3-13-26-18-11-9-17(10-12-18)25-21-20-19(16-7-5-4-6-8-16)14-27-22(20)24-15-23-21;/h4-12,14-15H,2-3,13H2,1H3,(H,23,24,25);1H |
| InChIKey | HBINGDFNMMEZTC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|