C20H15N3OS — CID 21009510
1-[4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]ethanone (PubChem CID 21009510) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-[4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]ethanone.
| Compound Name | 1-[4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 21009510 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-[4-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2ncnc3scc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C20H15N3OS/c1-13(24)14-7-9-16(10-8-14)23-19-18-17(15-5-3-2-4-6-15)11-25-20(18)22-12-21-19/h2-12H,1H3,(H,21,22,23) |
| InChIKey | QFSXKGPTTUFICQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |