C20H14ClN3O2S — CID 21011894
methyl 4-chloro-3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoate (PubChem CID 21011894) has the molecular formula C20H14ClN3O2S and a molecular weight of 395.87 g/mol. Its IUPAC name is methyl 4-chloro-3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoate.
| Compound Name | methyl 4-chloro-3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 21011894 |
| Molecular Formula | C20H14ClN3O2S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | methyl 4-chloro-3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(Nc2ncnc3scc(-c4ccccc4)c23)c1 |
| InChI | InChI=1S/C20H14ClN3O2S/c1-26-20(25)13-7-8-15(21)16(9-13)24-18-17-14(12-5-3-2-4-6-12)10-27-19(17)23-11-22-18/h2-11H,1H3,(H,22,23,24) |
| InChIKey | DGTCFHXJKGSHNQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |