C18H10Cl3N3S — CID 110659879
5-phenyl-N-(2,4,6-trichlorophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 110659879) has the molecular formula C18H10Cl3N3S and a molecular weight of 406.73 g/mol. Its IUPAC name is 5-phenyl-N-(2,4,6-trichlorophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-phenyl-N-(2,4,6-trichlorophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110659879 |
| Molecular Formula | C18H10Cl3N3S |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | 5-phenyl-N-(2,4,6-trichlorophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1cc(Cl)c(Nc2ncnc3scc(-c4ccccc4)c23)c(Cl)c1 |
| InChI | InChI=1S/C18H10Cl3N3S/c19-11-6-13(20)16(14(21)7-11)24-17-15-12(10-4-2-1-3-5-10)8-25-18(15)23-9-22-17/h1-9H,(H,22,23,24) |
| InChIKey | OGHMENOFGWKLSG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |