C14H13ClN2S — CID 144926094
4-chloro-5-phenylthieno[2,3-d]pyrimidine;ethane (PubChem CID 144926094) has the molecular formula C14H13ClN2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 4-chloro-5-phenylthieno[2,3-d]pyrimidine;ethane.
| Compound Name | 4-chloro-5-phenylthieno[2,3-d]pyrimidine;ethane |
|---|---|
| PubChem CID | 144926094 |
| Molecular Formula | C14H13ClN2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 4-chloro-5-phenylthieno[2,3-d]pyrimidine;ethane |
| SMILES | CC.Clc1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C12H7ClN2S.C2H6/c13-11-10-9(8-4-2-1-3-5-8)6-16-12(10)15-7-14-11;1-2/h1-7H;1-2H3 |
| InChIKey | HNOOHXBZXOSGEL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |