C18H19N3S — CID 675438
4-(4-methylpiperidin-1-yl)-5-phenylthieno[2,3-d]pyrimidine (PubChem CID 675438) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 4-(4-methylpiperidin-1-yl)-5-phenylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(4-methylpiperidin-1-yl)-5-phenylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 675438 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-(4-methylpiperidin-1-yl)-5-phenylthieno[2,3-d]pyrimidine |
| SMILES | CC1CCN(c2ncnc3scc(-c4ccccc4)c23)CC1 |
| InChI | InChI=1S/C18H19N3S/c1-13-7-9-21(10-8-13)17-16-15(14-5-3-2-4-6-14)11-22-18(16)20-12-19-17/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | LGHDDAZTYXWPNN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |