C16H17N4S+ — CID 6922306
5-phenyl-4-piperazin-4-ium-1-ylthieno[2,3-d]pyrimidine (PubChem CID 6922306) has the molecular formula C16H17N4S+ and a molecular weight of 297.41 g/mol. Its IUPAC name is 5-phenyl-4-piperazin-4-ium-1-ylthieno[2,3-d]pyrimidine.
| Compound Name | 5-phenyl-4-piperazin-4-ium-1-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 6922306 |
| Molecular Formula | C16H17N4S+ |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 5-phenyl-4-piperazin-4-ium-1-ylthieno[2,3-d]pyrimidine |
| SMILES | c1ccc(-c2csc3ncnc(N4CC[NH2+]CC4)c23)cc1 |
| InChI | InChI=1S/C16H16N4S/c1-2-4-12(5-3-1)13-10-21-16-14(13)15(18-11-19-16)20-8-6-17-7-9-20/h1-5,10-11,17H,6-9H2/p+1 |
| InChIKey | CROSIIFKOPCIFE-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 45.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |