C23H21ClN4S — CID 16553301
4-(4-benzylpiperazin-1-yl)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine (PubChem CID 16553301) has the molecular formula C23H21ClN4S and a molecular weight of 420.97 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 16553301 |
| Molecular Formula | C23H21ClN4S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine |
| SMILES | Clc1ccc(-c2csc3ncnc(N4CCN(Cc5ccccc5)CC4)c23)cc1 |
| InChI | InChI=1S/C23H21ClN4S/c24-19-8-6-18(7-9-19)20-15-29-23-21(20)22(25-16-26-23)28-12-10-27(11-13-28)14-17-4-2-1-3-5-17/h1-9,15-16H,10-14H2 |
| InChIKey | NKVKYJXOIZZEDT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |