C24H24N4OS — CID 1189434
4-(4-benzylpiperazin-1-yl)-5-(4-methoxyphenyl)thieno[2,3-d]pyrimidine (PubChem CID 1189434) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-5-(4-methoxyphenyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-5-(4-methoxyphenyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 1189434 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-5-(4-methoxyphenyl)thieno[2,3-d]pyrimidine |
| SMILES | COc1ccc(-c2csc3ncnc(N4CCN(Cc5ccccc5)CC4)c23)cc1 |
| InChI | InChI=1S/C24H24N4OS/c1-29-20-9-7-19(8-10-20)21-16-30-24-22(21)23(25-17-26-24)28-13-11-27(12-14-28)15-18-5-3-2-4-6-18/h2-10,16-17H,11-15H2,1H3 |
| InChIKey | BOQRXNAAYVHGSM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |