C18H17N5S — CID 23736071
2-[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]acetonitrile (PubChem CID 23736071) has the molecular formula C18H17N5S and a molecular weight of 335.44 g/mol. Its IUPAC name is 2-[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 23736071 |
| Molecular Formula | C18H17N5S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]acetonitrile |
| SMILES | N#CCN1CCN(c2ncnc3scc(-c4ccccc4)c23)CC1 |
| InChI | InChI=1S/C18H17N5S/c19-6-7-22-8-10-23(11-9-22)17-16-15(14-4-2-1-3-5-14)12-24-18(16)21-13-20-17/h1-5,12-13H,7-11H2 |
| InChIKey | YMURJYRKJUODQX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|