C22H19FN4O2S2 — CID 1323094
4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-5-phenylthieno[2,3-d]pyrimidine (PubChem CID 1323094) has the molecular formula C22H19FN4O2S2 and a molecular weight of 454.55 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-5-phenylthieno[2,3-d]pyrimidine.
| Compound Name | 4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-5-phenylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 1323094 |
| Molecular Formula | C22H19FN4O2S2 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-5-phenylthieno[2,3-d]pyrimidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCN(c2ncnc3scc(-c4ccccc4)c23)CC1 |
| InChI | InChI=1S/C22H19FN4O2S2/c23-17-6-8-18(9-7-17)31(28,29)27-12-10-26(11-13-27)21-20-19(16-4-2-1-3-5-16)14-30-22(20)25-15-24-21/h1-9,14-15H,10-13H2 |
| InChIKey | LPJHBZHJDJTHKX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |