C12H7IN2S — CID 147258357
4-iodo-5-phenylthieno[2,3-d]pyrimidine (PubChem CID 147258357) has the molecular formula C12H7IN2S and a molecular weight of 338.17 g/mol. Its IUPAC name is 4-iodo-5-phenylthieno[2,3-d]pyrimidine.
| Compound Name | 4-iodo-5-phenylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 147258357 |
| Molecular Formula | C12H7IN2S |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | 4-iodo-5-phenylthieno[2,3-d]pyrimidine |
| SMILES | Ic1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C12H7IN2S/c13-11-10-9(8-4-2-1-3-5-8)6-16-12(10)15-7-14-11/h1-7H |
| InChIKey | COBPEKWUBRPIGI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|