C17H19N3OS — CID 28849745
5-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-1-ol (PubChem CID 28849745) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 5-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-1-ol.
| Compound Name | 5-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 28849745 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 5-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-1-ol |
| SMILES | OCCCCCNc1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C17H19N3OS/c21-10-6-2-5-9-18-16-15-14(13-7-3-1-4-8-13)11-22-17(15)20-12-19-16/h1,3-4,7-8,11-12,21H,2,5-6,9-10H2,(H,18,19,20) |
| InChIKey | YYFOTLMSEJEYHS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|