C18H16N4O3S — CID 2796110
4-oxo-4-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethylamino]but-2-enoic acid (PubChem CID 2796110) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 4-oxo-4-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethylamino]but-2-enoic acid.
| Compound Name | 4-oxo-4-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 2796110 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-oxo-4-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethylamino]but-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NCCNc1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H16N4O3S/c23-14(6-7-15(24)25)19-8-9-20-17-16-13(12-4-2-1-3-5-12)10-26-18(16)22-11-21-17/h1-7,10-11H,8-9H2,(H,19,23)(H,24,25)(H,20,21,22) |
| InChIKey | ZLMWHZCEYXFTGF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|