C21H17ClN4OS — CID 46443926
2-chloro-N-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide (PubChem CID 46443926) has the molecular formula C21H17ClN4OS and a molecular weight of 408.91 g/mol. Its IUPAC name is 2-chloro-N-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 46443926 |
| Molecular Formula | C21H17ClN4OS |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-chloro-N-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1ncnc2scc(-c3ccccc3)c12)c1ccccc1Cl |
| InChI | InChI=1S/C21H17ClN4OS/c22-17-9-5-4-8-15(17)20(27)24-11-10-23-19-18-16(14-6-2-1-3-7-14)12-28-21(18)26-13-25-19/h1-9,12-13H,10-11H2,(H,24,27)(H,23,25,26) |
| InChIKey | DBJFIMAKAYGPKU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|