C15H13N3O2S — CID 4076019
2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]propanoic acid (PubChem CID 4076019) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]propanoic acid.
| Compound Name | 2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 4076019 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]propanoic acid |
| SMILES | CC(Nc1ncnc2scc(-c3ccccc3)c12)C(=O)O |
| InChI | InChI=1S/C15H13N3O2S/c1-9(15(19)20)18-13-12-11(10-5-3-2-4-6-10)7-21-14(12)17-8-16-13/h2-9H,1H3,(H,19,20)(H,16,17,18) |
| InChIKey | JILRVONTUYODMN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |