C18H17N3O4S — CID 82022263
2-[[5-(4-ethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]butanedioic acid (PubChem CID 82022263) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-[[5-(4-ethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]butanedioic acid.
| Compound Name | 2-[[5-(4-ethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]butanedioic acid |
|---|---|
| PubChem CID | 82022263 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[[5-(4-ethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]butanedioic acid |
| SMILES | CCc1ccc(-c2csc3ncnc(NC(CC(=O)O)C(=O)O)c23)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-2-10-3-5-11(6-4-10)12-8-26-17-15(12)16(19-9-20-17)21-13(18(24)25)7-14(22)23/h3-6,8-9,13H,2,7H2,1H3,(H,22,23)(H,24,25)(H,19,20,21) |
| InChIKey | PYAWCLNWOXOUQL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |