C20H18N4O2S2 — CID 2424566
4-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 2424566) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2424566 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 4-[2-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2ncnc3scc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C20H18N4O2S2/c21-28(25,26)16-8-6-14(7-9-16)10-11-22-19-18-17(15-4-2-1-3-5-15)12-27-20(18)24-13-23-19/h1-9,12-13H,10-11H2,(H2,21,25,26)(H,22,23,24) |
| InChIKey | CMDOKUDYRPGIRL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |