C22H21N3OS — CID 46347943
5-(4-methoxyphenyl)-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 46347943) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-methoxyphenyl)-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46347943 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(-c2csc3ncnc(NCCCc4ccccc4)c23)cc1 |
| InChI | InChI=1S/C22H21N3OS/c1-26-18-11-9-17(10-12-18)19-14-27-22-20(19)21(24-15-25-22)23-13-5-8-16-6-3-2-4-7-16/h2-4,6-7,9-12,14-15H,5,8,13H2,1H3,(H,23,24,25) |
| InChIKey | CLQOYWBILYDDRP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|