C17H16FN3O2S — CID 9195748
methyl 4-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]butanoate (PubChem CID 9195748) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 4-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]butanoate.
| Compound Name | methyl 4-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 9195748 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | methyl 4-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]butanoate |
| SMILES | COC(=O)CCCNc1ncnc2scc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C17H16FN3O2S/c1-23-14(22)3-2-8-19-16-15-13(9-24-17(15)21-10-20-16)11-4-6-12(18)7-5-11/h4-7,9-10H,2-3,8H2,1H3,(H,19,20,21) |
| InChIKey | BAJRCCUUAOMECZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|