C23H21FN4O2S — CID 11662066
methyl 3-[[2-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethylamino]methyl]benzoate (PubChem CID 11662066) has the molecular formula C23H21FN4O2S and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 3-[[2-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethylamino]methyl]benzoate.
| Compound Name | methyl 3-[[2-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 11662066 |
| Molecular Formula | C23H21FN4O2S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | methyl 3-[[2-[[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]ethylamino]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CNCCNc2ncnc3scc(-c4ccc(F)cc4)c23)c1 |
| InChI | InChI=1S/C23H21FN4O2S/c1-30-23(29)17-4-2-3-15(11-17)12-25-9-10-26-21-20-19(13-31-22(20)28-14-27-21)16-5-7-18(24)8-6-16/h2-8,11,13-14,25H,9-10,12H2,1H3,(H,26,27,28) |
| InChIKey | XLCOCKURZARQRW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|