C22H18FN3O4S — CID 11503064
methyl 5-[3-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxypropoxy]pyridine-3-carboxylate (PubChem CID 11503064) has the molecular formula C22H18FN3O4S and a molecular weight of 439.47 g/mol. Its IUPAC name is methyl 5-[3-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxypropoxy]pyridine-3-carboxylate.
| Compound Name | methyl 5-[3-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxypropoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 11503064 |
| Molecular Formula | C22H18FN3O4S |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | methyl 5-[3-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxypropoxy]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(OCCCOc2ncnc3scc(-c4ccc(F)cc4)c23)c1 |
| InChI | InChI=1S/C22H18FN3O4S/c1-28-22(27)15-9-17(11-24-10-15)29-7-2-8-30-20-19-18(12-31-21(19)26-13-25-20)14-3-5-16(23)6-4-14/h3-6,9-13H,2,7-8H2,1H3 |
| InChIKey | LOPHXLFTQMIZNE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|