C21H17FN2O2S — CID 11668030
5-(4-fluorophenyl)-4-(3-phenoxypropoxy)thieno[2,3-d]pyrimidine (PubChem CID 11668030) has the molecular formula C21H17FN2O2S and a molecular weight of 380.44 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-(3-phenoxypropoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 5-(4-fluorophenyl)-4-(3-phenoxypropoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 11668030 |
| Molecular Formula | C21H17FN2O2S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 5-(4-fluorophenyl)-4-(3-phenoxypropoxy)thieno[2,3-d]pyrimidine |
| SMILES | Fc1ccc(-c2csc3ncnc(OCCCOc4ccccc4)c23)cc1 |
| InChI | InChI=1S/C21H17FN2O2S/c22-16-9-7-15(8-10-16)18-13-27-21-19(18)20(23-14-24-21)26-12-4-11-25-17-5-2-1-3-6-17/h1-3,5-10,13-14H,4,11-12H2 |
| InChIKey | SXGFENWNHKBEKR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|