C19H13ClN2O2S — CID 1228156
5-(4-chlorophenyl)-4-(2-methoxyphenoxy)thieno[2,3-d]pyrimidine (PubChem CID 1228156) has the molecular formula C19H13ClN2O2S and a molecular weight of 368.85 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(2-methoxyphenoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 5-(4-chlorophenyl)-4-(2-methoxyphenoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 1228156 |
| Molecular Formula | C19H13ClN2O2S |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(2-methoxyphenoxy)thieno[2,3-d]pyrimidine |
| SMILES | COc1ccccc1Oc1ncnc2scc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C19H13ClN2O2S/c1-23-15-4-2-3-5-16(15)24-18-17-14(10-25-19(17)22-11-21-18)12-6-8-13(20)9-7-12/h2-11H,1H3 |
| InChIKey | PYAINUJZWZVBOV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |