C17H10ClN3S — CID 67382265
5-(4-chlorophenyl)-4-pyridin-2-ylthieno[2,3-d]pyrimidine (PubChem CID 67382265) has the molecular formula C17H10ClN3S and a molecular weight of 323.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-pyridin-2-ylthieno[2,3-d]pyrimidine.
| Compound Name | 5-(4-chlorophenyl)-4-pyridin-2-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 67382265 |
| Molecular Formula | C17H10ClN3S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 5-(4-chlorophenyl)-4-pyridin-2-ylthieno[2,3-d]pyrimidine |
| SMILES | Clc1ccc(-c2csc3ncnc(-c4ccccn4)c23)cc1 |
| InChI | InChI=1S/C17H10ClN3S/c18-12-6-4-11(5-7-12)13-9-22-17-15(13)16(20-10-21-17)14-3-1-2-8-19-14/h1-10H |
| InChIKey | RZVLMPTVUPSYOV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |