C14H13N3O2S — CID 40773451
5-(3,4-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 40773451) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(3,4-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 40773451 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(-c2csc3ncnc(N)c23)cc1OC |
| InChI | InChI=1S/C14H13N3O2S/c1-18-10-4-3-8(5-11(10)19-2)9-6-20-14-12(9)13(15)16-7-17-14/h3-7H,1-2H3,(H2,15,16,17) |
| InChIKey | WNRGNVPXPSXMRJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |