C26H21N3O3S — CID 21011253
5-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 21011253) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21011253 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(-c2csc3ncnc(Nc4ccc(Oc5ccccc5)cc4)c23)cc1OC |
| InChI | InChI=1S/C26H21N3O3S/c1-30-22-13-8-17(14-23(22)31-2)21-15-33-26-24(21)25(27-16-28-26)29-18-9-11-20(12-10-18)32-19-6-4-3-5-7-19/h3-16H,1-2H3,(H,27,28,29) |
| InChIKey | BWUMBZPWDDYEQH-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |