C25H19N3OS — CID 2391301
5-(4-methylphenyl)-N-(3-phenoxyphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 2391301) has the molecular formula C25H19N3OS and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-(4-methylphenyl)-N-(3-phenoxyphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-methylphenyl)-N-(3-phenoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 2391301 |
| Molecular Formula | C25H19N3OS |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-(4-methylphenyl)-N-(3-phenoxyphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(-c2csc3ncnc(Nc4cccc(Oc5ccccc5)c4)c23)cc1 |
| InChI | InChI=1S/C25H19N3OS/c1-17-10-12-18(13-11-17)22-15-30-25-23(22)24(26-16-27-25)28-19-6-5-9-21(14-19)29-20-7-3-2-4-8-20/h2-16H,1H3,(H,26,27,28) |
| InChIKey | LVCRXGHQPAGNSF-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |