C18H12BrN3S — CID 21010054
N-(3-bromophenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 21010054) has the molecular formula C18H12BrN3S and a molecular weight of 382.29 g/mol. Its IUPAC name is N-(3-bromophenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-bromophenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21010054 |
| Molecular Formula | C18H12BrN3S |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | N-(3-bromophenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Brc1cccc(Nc2ncnc3scc(-c4ccccc4)c23)c1 |
| InChI | InChI=1S/C18H12BrN3S/c19-13-7-4-8-14(9-13)22-17-16-15(12-5-2-1-3-6-12)10-23-18(16)21-11-20-17/h1-11H,(H,20,21,22) |
| InChIKey | ZFTYEXQMCDSSOJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |