C19H12ClN3O2S — CID 20997842
3-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]benzoic acid (PubChem CID 20997842) has the molecular formula C19H12ClN3O2S and a molecular weight of 381.84 g/mol. Its IUPAC name is 3-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 20997842 |
| Molecular Formula | C19H12ClN3O2S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 3-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2ncnc3scc(-c4ccc(Cl)cc4)c23)c1 |
| InChI | InChI=1S/C19H12ClN3O2S/c20-13-6-4-11(5-7-13)15-9-26-18-16(15)17(21-10-22-18)23-14-3-1-2-12(8-14)19(24)25/h1-10H,(H,24,25)(H,21,22,23) |
| InChIKey | RQZUCMUNQZBEIX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |