C21H19N3O3S — CID 21011196
2-[[5-(3,4-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-4-methylphenol (PubChem CID 21011196) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-4-methylphenol.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-4-methylphenol |
|---|---|
| PubChem CID | 21011196 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-4-methylphenol |
| SMILES | COc1ccc(-c2csc3ncnc(Nc4cc(C)ccc4O)c23)cc1OC |
| InChI | InChI=1S/C21H19N3O3S/c1-12-4-6-16(25)15(8-12)24-20-19-14(10-28-21(19)23-11-22-20)13-5-7-17(26-2)18(9-13)27-3/h4-11,25H,1-3H3,(H,22,23,24) |
| InChIKey | GELJKXKJMKLNBH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|