C25H17ClN2OS — CID 5220220
4-(4-benzylphenoxy)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine (PubChem CID 5220220) has the molecular formula C25H17ClN2OS and a molecular weight of 428.94 g/mol. Its IUPAC name is 4-(4-benzylphenoxy)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-(4-benzylphenoxy)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 5220220 |
| Molecular Formula | C25H17ClN2OS |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4-(4-benzylphenoxy)-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine |
| SMILES | Clc1ccc(-c2csc3ncnc(Oc4ccc(Cc5ccccc5)cc4)c23)cc1 |
| InChI | InChI=1S/C25H17ClN2OS/c26-20-10-8-19(9-11-20)22-15-30-25-23(22)24(27-16-28-25)29-21-12-6-18(7-13-21)14-17-4-2-1-3-5-17/h1-13,15-16H,14H2 |
| InChIKey | RIASHPMBTMVGDO-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |