C18H11N3O3S — CID 17429787
4-(3-nitrophenoxy)-5-phenylthieno[2,3-d]pyrimidine (PubChem CID 17429787) has the molecular formula C18H11N3O3S and a molecular weight of 349.37 g/mol. Its IUPAC name is 4-(3-nitrophenoxy)-5-phenylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(3-nitrophenoxy)-5-phenylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 17429787 |
| Molecular Formula | C18H11N3O3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-(3-nitrophenoxy)-5-phenylthieno[2,3-d]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc(Oc2ncnc3scc(-c4ccccc4)c23)c1 |
| InChI | InChI=1S/C18H11N3O3S/c22-21(23)13-7-4-8-14(9-13)24-17-16-15(12-5-2-1-3-6-12)10-25-18(16)20-11-19-17/h1-11H |
| InChIKey | YLFDYCBDPJXPGL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|