C19H15ClN4O2S — CID 44635775
N-(4-methylphenyl)-5-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride (PubChem CID 44635775) has the molecular formula C19H15ClN4O2S and a molecular weight of 398.88 g/mol. Its IUPAC name is N-(4-methylphenyl)-5-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride.
| Compound Name | N-(4-methylphenyl)-5-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 44635775 |
| Molecular Formula | C19H15ClN4O2S |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-(4-methylphenyl)-5-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine;hydrochloride |
| SMILES | Cc1ccc(Nc2ncnc3scc(-c4cccc([N+](=O)[O-])c4)c23)cc1.Cl |
| InChI | InChI=1S/C19H14N4O2S.ClH/c1-12-5-7-14(8-6-12)22-18-17-16(10-26-19(17)21-11-20-18)13-3-2-4-15(9-13)23(24)25;/h2-11H,1H3,(H,20,21,22);1H |
| InChIKey | NGZOICOSGAJKCC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|