C19H13FN4O2S — CID 21010769
5-(4-fluorophenyl)-N-(2-methyl-5-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 21010769) has the molecular formula C19H13FN4O2S and a molecular weight of 380.40 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(2-methyl-5-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-fluorophenyl)-N-(2-methyl-5-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21010769 |
| Molecular Formula | C19H13FN4O2S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(2-methyl-5-nitrophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1ccc([N+](=O)[O-])cc1Nc1ncnc2scc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C19H13FN4O2S/c1-11-2-7-14(24(25)26)8-16(11)23-18-17-15(9-27-19(17)22-10-21-18)12-3-5-13(20)6-4-12/h2-10H,1H3,(H,21,22,23) |
| InChIKey | OGPZMBMKYWEIHT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|