C21H17FN4O2S — CID 110499142
N-(3-fluoro-4-nitrophenyl)-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 110499142) has the molecular formula C21H17FN4O2S and a molecular weight of 408.46 g/mol. Its IUPAC name is N-(3-fluoro-4-nitrophenyl)-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-fluoro-4-nitrophenyl)-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110499142 |
| Molecular Formula | C21H17FN4O2S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-(3-fluoro-4-nitrophenyl)-5-(4-propan-2-ylphenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)c1ccc(-c2csc3ncnc(Nc4ccc([N+](=O)[O-])c(F)c4)c23)cc1 |
| InChI | InChI=1S/C21H17FN4O2S/c1-12(2)13-3-5-14(6-4-13)16-10-29-21-19(16)20(23-11-24-21)25-15-7-8-18(26(27)28)17(22)9-15/h3-12H,1-2H3,(H,23,24,25) |
| InChIKey | QSPFFRXMKQLSKJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|