C18H13N5O2S — CID 28850524
4-N-[5-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine (PubChem CID 28850524) has the molecular formula C18H13N5O2S and a molecular weight of 363.40 g/mol. Its IUPAC name is 4-N-[5-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[5-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 28850524 |
| Molecular Formula | C18H13N5O2S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 4-N-[5-(3-nitrophenyl)thieno[2,3-d]pyrimidin-4-yl]benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ncnc3scc(-c4cccc([N+](=O)[O-])c4)c23)cc1 |
| InChI | InChI=1S/C18H13N5O2S/c19-12-4-6-13(7-5-12)22-17-16-15(9-26-18(16)21-10-20-17)11-2-1-3-14(8-11)23(24)25/h1-10H,19H2,(H,20,21,22) |
| InChIKey | FCABPDMZDWMDHR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|