C19H12N5O3S- — CID 7735261
4-nitro-2-[(Z)-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenolate (PubChem CID 7735261) has the molecular formula C19H12N5O3S- and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-nitro-2-[(Z)-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenolate.
| Compound Name | 4-nitro-2-[(Z)-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 7735261 |
| Molecular Formula | C19H12N5O3S- |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-nitro-2-[(Z)-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenolate |
| SMILES | O=[N+]([O-])c1ccc([O-])c(/C=N\Nc2ncnc3scc(-c4ccccc4)c23)c1 |
| InChI | InChI=1S/C19H13N5O3S/c25-16-7-6-14(24(26)27)8-13(16)9-22-23-18-17-15(12-4-2-1-3-5-12)10-28-19(17)21-11-20-18/h1-11,25H,(H,20,21,23)/p-1/b22-9- |
| InChIKey | XSDBJAWXNHDIEZ-AFPJDJCSSA-M |
| XLogP | 3.79 |
| TPSA | 116.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|