C24H17N5O4S — CID 5166577
N-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 5166577) has the molecular formula C24H17N5O4S and a molecular weight of 471.50 g/mol. Its IUPAC name is N-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 5166577 |
| Molecular Formula | C24H17N5O4S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | N-[[5-(2-methoxy-5-nitrophenyl)furan-2-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc([N+](=O)[O-])cc1-c1ccc(C=NNc2ncnc3scc(-c4ccccc4)c23)o1 |
| InChI | InChI=1S/C24H17N5O4S/c1-32-20-9-7-16(29(30)31)11-18(20)21-10-8-17(33-21)12-27-28-23-22-19(15-5-3-2-4-6-15)13-34-24(22)26-14-25-23/h2-14H,1H3,(H,25,26,28) |
| InChIKey | PRVXVPMBNHLUNP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|