C22H17N5OS — CID 135651634
N-[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 135651634) has the molecular formula C22H17N5OS and a molecular weight of 399.48 g/mol. Its IUPAC name is N-[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 135651634 |
| Molecular Formula | C22H17N5OS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[(E)-(5-methoxy-1H-indol-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc2[nH]cc(/C=N/Nc3ncnc4scc(-c5ccccc5)c34)c2c1 |
| InChI | InChI=1S/C22H17N5OS/c1-28-16-7-8-19-17(9-16)15(10-23-19)11-26-27-21-20-18(14-5-3-2-4-6-14)12-29-22(20)25-13-24-21/h2-13,23H,1H3,(H,24,25,27)/b26-11+ |
| InChIKey | CLBCBEOSSAGBCH-KBKYJPHKSA-N |
| XLogP | 5.29 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|