C22H17N5S — CID 135651619
N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 135651619) has the molecular formula C22H17N5S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 135651619 |
| Molecular Formula | C22H17N5S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/Nc1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C22H17N5S/c1-14-17(16-9-5-6-10-19(16)26-14)11-25-27-21-20-18(15-7-3-2-4-8-15)12-28-22(20)24-13-23-21/h2-13,26H,1H3,(H,23,24,27)/b25-11+ |
| InChIKey | WJFQDECQIIGXBM-OPEKNORGSA-N |
| XLogP | 5.59 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|