C19H13BrN4OS — CID 135651752
4-bromo-2-[(E)-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol (PubChem CID 135651752) has the molecular formula C19H13BrN4OS and a molecular weight of 425.31 g/mol. Its IUPAC name is 4-bromo-2-[(E)-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-[(E)-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135651752 |
| Molecular Formula | C19H13BrN4OS |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 4-bromo-2-[(E)-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(Br)cc1/C=N/Nc1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C19H13BrN4OS/c20-14-6-7-16(25)13(8-14)9-23-24-18-17-15(12-4-2-1-3-5-12)10-26-19(17)22-11-21-18/h1-11,25H,(H,21,22,24)/b23-9+ |
| InChIKey | KEICPTUDLMCUBO-NUGSKGIGSA-N |
| XLogP | 5.27 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|